About 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol
3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol (PubChem CID 123294934) has the molecular formula C9H18F3NO
and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol.
Molecular Properties
| Compound Name | 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol |
| PubChem CID | 123294934 |
| Molecular Formula | C9H18F3NO |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol |
| SMILES | CC(O)C(C)CN(C)C(C)C(F)(F)F |
| InChI | InChI=1S/C9H18F3NO/c1-6(7(2)14)5-13(4)8(3)9(10,11)12/h6-8,14H,5H2,1-4H3 |
| InChIKey | UOTFHOGFMYHNBP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol?
The IUPAC name of 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol (CID 123294934) is 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol.
What is the SMILES notation for 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol?
The canonical SMILES for 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol is CC(O)C(C)CN(C)C(C)C(F)(F)F.
What is the InChIKey of 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol?
The InChIKey is UOTFHOGFMYHNBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3NO/c1-6(7(2)14)5-13(4)8(3)9(10,11)12/h6-8,14H,5H2,1-4H3.
What are the key properties of 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol?
3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol has a molecular weight of 213.24 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[methyl(1,1,1-trifluoropropan-2-yl)amino]butan-2-ol is sourced from PubChem (CID 123294934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).