C44H54N4 — CID 123295135
1-[4-[2-[3,5-dimethyl-4-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenyl]ethyl]-2,6-dimethylphenyl]-4,5-dimethyl-3-(2,4,6-trimethylphenyl)-2H-imidazole (PubChem CID 123295135) has the molecular formula C44H54N4 and a molecular weight of 638.94 g/mol. Its IUPAC name is 1-[4-[2-[3,5-dimethyl-4-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenyl]ethyl]-2,6-dimethylphenyl]-4,5-dimethyl-3-(2,4,6-trimethylphenyl)-2H-imidazole.
| Compound Name | 1-[4-[2-[3,5-dimethyl-4-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenyl]ethyl]-2,6-dimethylphenyl]-4,5-dimethyl-3-(2,4,6-trimethylphenyl)-2H-imidazole |
|---|---|
| PubChem CID | 123295135 |
| Molecular Formula | C44H54N4 |
| Molecular Weight | 638.94 g/mol |
| Exact Mass | 638.43 |
| IUPAC Name | 1-[4-[2-[3,5-dimethyl-4-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]phenyl]ethyl]-2,6-dimethylphenyl]-4,5-dimethyl-3-(2,4,6-trimethylphenyl)-2H-imidazole |
| SMILES | CC1=C(C)N(c2c(C)cc(CCc3cc(C)c(N4C=CN(c5c(C)cc(C)cc5C)C4)c(C)c3)cc2C)CN1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C44H54N4/c1-27-17-29(3)41(30(4)18-27)45-15-16-46(25-45)42-33(7)21-39(22-34(42)8)13-14-40-23-35(9)44(36(10)24-40)48-26-47(37(11)38(48)12)43-31(5)19-28(2)20-32(43)6/h15-24H,13-14,25-26H2,1-12H3 |
| InChIKey | QKGKXAUWEJWANV-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.94 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |