About 4-ethyl-5-fluorohepta-4,6-dien-3-imine
4-ethyl-5-fluorohepta-4,6-dien-3-imine (PubChem CID 123295188) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is 4-ethyl-5-fluorohepta-4,6-dien-3-imine.
Molecular Properties
| Compound Name | 4-ethyl-5-fluorohepta-4,6-dien-3-imine |
| PubChem CID | 123295188 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 4-ethyl-5-fluorohepta-4,6-dien-3-imine |
| SMILES | [H]/N=C(\CC)C(CC)=C(F)C=C |
| InChI | InChI=1S/C9H14FN/c1-4-7(8(10)5-2)9(11)6-3/h5,11H,2,4,6H2,1,3H3/b8-7?,11-9+ |
| InChIKey | RBSUENPPEZLTPS-MVOABLDTSA-N |
| XLogP | 3.24 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-5-fluorohepta-4,6-dien-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-fluorohepta-4,6-dien-3-imine?
The IUPAC name of 4-ethyl-5-fluorohepta-4,6-dien-3-imine (CID 123295188) is 4-ethyl-5-fluorohepta-4,6-dien-3-imine.
What is the SMILES notation for 4-ethyl-5-fluorohepta-4,6-dien-3-imine?
The canonical SMILES for 4-ethyl-5-fluorohepta-4,6-dien-3-imine is [H]/N=C(\CC)C(CC)=C(F)C=C.
What is the InChIKey of 4-ethyl-5-fluorohepta-4,6-dien-3-imine?
The InChIKey is RBSUENPPEZLTPS-MVOABLDTSA-N. The full InChI is InChI=1S/C9H14FN/c1-4-7(8(10)5-2)9(11)6-3/h5,11H,2,4,6H2,1,3H3/b8-7?,11-9+.
What are the key properties of 4-ethyl-5-fluorohepta-4,6-dien-3-imine?
4-ethyl-5-fluorohepta-4,6-dien-3-imine has a molecular weight of 155.22 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-fluorohepta-4,6-dien-3-imine is sourced from PubChem (CID 123295188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).