About 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole
2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole (PubChem CID 123295545) has the molecular formula C12H10N2O
and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole |
| PubChem CID | 123295545 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc2c(C3=NCCO3)nccc2c1 |
| InChI | InChI=1S/C12H10N2O/c1-2-4-10-9(3-1)5-6-13-11(10)12-14-7-8-15-12/h1-6H,7-8H2 |
| InChIKey | ZJBRZBITZHGNQB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole (CID 123295545) is 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole is c1ccc2c(C3=NCCO3)nccc2c1.
What is the InChIKey of 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole?
The InChIKey is ZJBRZBITZHGNQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c1-2-4-10-9(3-1)5-6-13-11(10)12-14-7-8-15-12/h1-6H,7-8H2.
What are the key properties of 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole?
2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole has a molecular weight of 198.23 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isoquinolin-1-yl-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 123295545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).