C37H32F3N5O — CID 123295892
1-[4-(4-but-1-en-2-ylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-3-methyl-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one (PubChem CID 123295892) has the molecular formula C37H32F3N5O and a molecular weight of 619.69 g/mol. Its IUPAC name is 1-[4-(4-but-1-en-2-ylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-3-methyl-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one.
| Compound Name | 1-[4-(4-but-1-en-2-ylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-3-methyl-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 123295892 |
| Molecular Formula | C37H32F3N5O |
| Molecular Weight | 619.69 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | 1-[4-(4-but-1-en-2-ylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-3-methyl-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one |
| SMILES | C=C(CC)N1CCN(c2ccc(-n3c(=O)c(C)cc4cnc5ccc(-c6cnc7ccccc7c6)cc5c43)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C37H32F3N5O/c1-4-24(3)43-13-15-44(16-14-43)34-12-10-29(20-31(34)37(38,39)40)45-35-28(17-23(2)36(45)46)22-42-33-11-9-25(19-30(33)35)27-18-26-7-5-6-8-32(26)41-21-27/h5-12,17-22H,3-4,13-16H2,1-2H3 |
| InChIKey | GMBQGBSXXLUTIX-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.69 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|