C20H26F3N3O4 — CID 123296209
1-[(1-cyclohexyl-2,2,2-trifluoroethyl)carbamoyl]-3-[2-[2-(methylideneamino)ethenyl]but-2-enyl]-4-oxoazetidine-2-carboxylic acid (PubChem CID 123296209) has the molecular formula C20H26F3N3O4 and a molecular weight of 429.44 g/mol. Its IUPAC name is 1-[(1-cyclohexyl-2,2,2-trifluoroethyl)carbamoyl]-3-[2-[2-(methylideneamino)ethenyl]but-2-enyl]-4-oxoazetidine-2-carboxylic acid.
| Compound Name | 1-[(1-cyclohexyl-2,2,2-trifluoroethyl)carbamoyl]-3-[2-[2-(methylideneamino)ethenyl]but-2-enyl]-4-oxoazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 123296209 |
| Molecular Formula | C20H26F3N3O4 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-[(1-cyclohexyl-2,2,2-trifluoroethyl)carbamoyl]-3-[2-[2-(methylideneamino)ethenyl]but-2-enyl]-4-oxoazetidine-2-carboxylic acid |
| SMILES | C=NC=CC(=CC)CC1C(=O)N(C(=O)NC(C2CCCCC2)C(F)(F)F)C1C(=O)O |
| InChI | InChI=1S/C20H26F3N3O4/c1-3-12(9-10-24-2)11-14-15(18(28)29)26(17(14)27)19(30)25-16(20(21,22)23)13-7-5-4-6-8-13/h3,9-10,13-16H,2,4-8,11H2,1H3,(H,25,30)(H,28,29) |
| InChIKey | VPTDFBYRZGDMRM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|