C24H24FN3O2 — CID 123297188
4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-2-methyl-4,6,7,8,9,9a-hexahydropyrrolo[3,4-a]indolizine-1,3-diol (PubChem CID 123297188) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is 4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-2-methyl-4,6,7,8,9,9a-hexahydropyrrolo[3,4-a]indolizine-1,3-diol.
| Compound Name | 4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-2-methyl-4,6,7,8,9,9a-hexahydropyrrolo[3,4-a]indolizine-1,3-diol |
|---|---|
| PubChem CID | 123297188 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-2-methyl-4,6,7,8,9,9a-hexahydropyrrolo[3,4-a]indolizine-1,3-diol |
| SMILES | Cn1c(O)c2c(c1O)C1CCCCN1C2/C=C/c1ccc(-c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C24H24FN3O2/c1-27-23(29)21-19-7-2-3-12-28(19)20(22(21)24(27)30)11-10-18-9-8-16(14-26-18)15-5-4-6-17(25)13-15/h4-6,8-11,13-14,19-20,29-30H,2-3,7,12H2,1H3/b11-10+ |
| InChIKey | UKQYPIUDHUSRFS-ZHACJKMWSA-N |
| XLogP | 4.93 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |