C17H35N3 — CID 123297227
3-N-[[ethyl(methyl)amino]methyl]-1-N,3-N-dimethyl-1-N-(5-methylhexa-2,4-dien-2-yl)butane-1,3-diamine (PubChem CID 123297227) has the molecular formula C17H35N3 and a molecular weight of 281.49 g/mol. Its IUPAC name is 3-N-[[ethyl(methyl)amino]methyl]-1-N,3-N-dimethyl-1-N-(5-methylhexa-2,4-dien-2-yl)butane-1,3-diamine.
| Compound Name | 3-N-[[ethyl(methyl)amino]methyl]-1-N,3-N-dimethyl-1-N-(5-methylhexa-2,4-dien-2-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 123297227 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | 3-N-[[ethyl(methyl)amino]methyl]-1-N,3-N-dimethyl-1-N-(5-methylhexa-2,4-dien-2-yl)butane-1,3-diamine |
| SMILES | CCN(C)CN(C)C(C)CCN(C)C(C)=CC=C(C)C |
| InChI | InChI=1S/C17H35N3/c1-9-18(6)14-20(8)17(5)12-13-19(7)16(4)11-10-15(2)3/h10-11,17H,9,12-14H2,1-8H3 |
| InChIKey | RTZUHNKRKRRDLM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|