About 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide
2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 123297278) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide |
| PubChem CID | 123297278 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | COCc1ncc(C(=O)N(C)C)o1 |
| InChI | InChI=1S/C8H12N2O3/c1-10(2)8(11)6-4-9-7(13-6)5-12-3/h4H,5H2,1-3H3 |
| InChIKey | NUCOXUOQVLMIST-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide?
The IUPAC name of 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide (CID 123297278) is 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide.
What is the SMILES notation for 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide?
The canonical SMILES for 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide is COCc1ncc(C(=O)N(C)C)o1.
What is the InChIKey of 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide?
The InChIKey is NUCOXUOQVLMIST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-10(2)8(11)6-4-9-7(13-6)5-12-3/h4H,5H2,1-3H3.
What are the key properties of 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide?
2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide has a molecular weight of 184.19 g/mol, XLogP of 0.52, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-N,N-dimethyl-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 123297278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).