C16H34NO+ — CID 123297412
3-[4-(2,2-dimethylpropyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-2,2-dimethylpropan-1-ol (PubChem CID 123297412) has the molecular formula C16H34NO+ and a molecular weight of 256.45 g/mol. Its IUPAC name is 3-[4-(2,2-dimethylpropyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[4-(2,2-dimethylpropyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 123297412 |
| Molecular Formula | C16H34NO+ |
| Molecular Weight | 256.45 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | 3-[4-(2,2-dimethylpropyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)CC1C[N+](C)(C)CC1CC(C)(C)CO |
| InChI | InChI=1S/C16H34NO/c1-15(2,3)8-13-10-17(6,7)11-14(13)9-16(4,5)12-18/h13-14,18H,8-12H2,1-7H3/q+1 |
| InChIKey | CJGMYIQCXGWJNM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|