C25H36F2O3 — CID 123297805
methyl 4-(10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2,2-difluoropentanoate (PubChem CID 123297805) has the molecular formula C25H36F2O3 and a molecular weight of 422.56 g/mol. Its IUPAC name is methyl 4-(10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2,2-difluoropentanoate.
| Compound Name | methyl 4-(10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2,2-difluoropentanoate |
|---|---|
| PubChem CID | 123297805 |
| Molecular Formula | C25H36F2O3 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | methyl 4-(10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)-2,2-difluoropentanoate |
| SMILES | COC(=O)C(F)(F)CC(C)C1CCC2C3CC=C4CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H36F2O3/c1-15(14-25(26,27)22(29)30-4)19-7-8-20-18-6-5-16-13-17(28)9-11-23(16,2)21(18)10-12-24(19,20)3/h5,15,18-21H,6-14H2,1-4H3 |
| InChIKey | SHGKXKCFLCMTDM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|