About 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine
6-fluoro-N,4-dimethylcyclohex-2-en-1-imine (PubChem CID 123297893) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine.
Molecular Properties
| Compound Name | 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine |
| PubChem CID | 123297893 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine |
| SMILES | C/N=C1\C=CC(C)CC1F |
| InChI | InChI=1S/C8H12FN/c1-6-3-4-8(10-2)7(9)5-6/h3-4,6-7H,5H2,1-2H3/b10-8+ |
| InChIKey | QQWGRMCDYJTFNL-CSKARUKUSA-N |
| XLogP | 1.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine?
The IUPAC name of 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine (CID 123297893) is 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine.
What is the SMILES notation for 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine?
The canonical SMILES for 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine is C/N=C1\C=CC(C)CC1F.
What is the InChIKey of 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine?
The InChIKey is QQWGRMCDYJTFNL-CSKARUKUSA-N. The full InChI is InChI=1S/C8H12FN/c1-6-3-4-8(10-2)7(9)5-6/h3-4,6-7H,5H2,1-2H3/b10-8+.
What are the key properties of 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine?
6-fluoro-N,4-dimethylcyclohex-2-en-1-imine has a molecular weight of 141.19 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine is sourced from PubChem (CID 123297893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).