C8H12FN — CID 123297893
6-fluoro-N,4-dimethylcyclohex-2-en-1-imine (PubChem CID 123297893) has the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. Its IUPAC name is 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine.
| Compound Name | 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123297893 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 6-fluoro-N,4-dimethylcyclohex-2-en-1-imine |
| SMILES | C/N=C1\C=CC(C)CC1F |
| InChI | InChI=1S/C8H12FN/c1-6-3-4-8(10-2)7(9)5-6/h3-4,6-7H,5H2,1-2H3/b10-8+ |
| InChIKey | QQWGRMCDYJTFNL-CSKARUKUSA-N |
| XLogP | 1.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|