About 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide
2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide (PubChem CID 123298330) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide |
| PubChem CID | 123298330 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide |
| SMILES | CNC(=O)Cn1c(O)cc(C)c1O |
| InChI | InChI=1S/C8H12N2O3/c1-5-3-7(12)10(8(5)13)4-6(11)9-2/h3,12-13H,4H2,1-2H3,(H,9,11) |
| InChIKey | YOZFATUHTZTASM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide?
The IUPAC name of 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide (CID 123298330) is 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide.
What is the SMILES notation for 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide?
The canonical SMILES for 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide is CNC(=O)Cn1c(O)cc(C)c1O.
What is the InChIKey of 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide?
The InChIKey is YOZFATUHTZTASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-5-3-7(12)10(8(5)13)4-6(11)9-2/h3,12-13H,4H2,1-2H3,(H,9,11).
What are the key properties of 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide?
2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide has a molecular weight of 184.19 g/mol, XLogP of -0.05, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-methylacetamide is sourced from PubChem (CID 123298330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).