About N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide
N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide (PubChem CID 123298661) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide |
| PubChem CID | 123298661 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide |
| SMILES | CC=CC=C(C=CC)N(C)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C16H25NO/c1-4-6-13-15(10-5-2)17(3)16(18)14-11-8-7-9-12-14/h4-6,10,13-14H,7-9,11-12H2,1-3H3 |
| InChIKey | KVZZVUSXLACGSR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide?
The IUPAC name of N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide (CID 123298661) is N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide.
What is the SMILES notation for N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide?
The canonical SMILES for N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide is CC=CC=C(C=CC)N(C)C(=O)C1CCCCC1.
What is the InChIKey of N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide?
The InChIKey is KVZZVUSXLACGSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO/c1-4-6-13-15(10-5-2)17(3)16(18)14-11-8-7-9-12-14/h4-6,10,13-14H,7-9,11-12H2,1-3H3.
What are the key properties of N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide?
N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide has a molecular weight of 247.38 g/mol, XLogP of 4.06, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-octa-2,4,6-trien-4-ylcyclohexanecarboxamide is sourced from PubChem (CID 123298661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).