C26H29N3O2 — CID 123299118
N-(6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl)-4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-N-methylbenzamide (PubChem CID 123299118) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl)-4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-N-methylbenzamide.
| Compound Name | N-(6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl)-4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 123299118 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-(6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl)-4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(CCNCC(O)c2ccccc2)cc1)C1CCc2ncccc21 |
| InChI | InChI=1S/C26H29N3O2/c1-29(24-14-13-23-22(24)8-5-16-28-23)26(31)21-11-9-19(10-12-21)15-17-27-18-25(30)20-6-3-2-4-7-20/h2-12,16,24-25,27,30H,13-15,17-18H2,1H3 |
| InChIKey | JPIFROMUAYJUOA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|