About [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate
[2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate (PubChem CID 123299269) has the molecular formula C14H14O4
and a molecular weight of 246.26 g/mol. Its IUPAC name is [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate.
Molecular Properties
| Compound Name | [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate |
| PubChem CID | 123299269 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate |
| SMILES | C=C(C(C)=O)C(OC(C)=O)c1cccc(=O)cc1 |
| InChI | InChI=1S/C14H14O4/c1-9(10(2)15)14(18-11(3)16)12-5-4-6-13(17)8-7-12/h4-8,14H,1H2,2-3H3 |
| InChIKey | QIVJLNZKSKOJQQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate?
The IUPAC name of [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate (CID 123299269) is [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate.
What is the SMILES notation for [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate?
The canonical SMILES for [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate is C=C(C(C)=O)C(OC(C)=O)c1cccc(=O)cc1.
What is the InChIKey of [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate?
The InChIKey is QIVJLNZKSKOJQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O4/c1-9(10(2)15)14(18-11(3)16)12-5-4-6-13(17)8-7-12/h4-8,14H,1H2,2-3H3.
What are the key properties of [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate?
[2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate has a molecular weight of 246.26 g/mol, XLogP of 1.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methylidene-3-oxo-1-(5-oxocyclohepta-1,3,6-trien-1-yl)butyl] acetate is sourced from PubChem (CID 123299269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).