C8H8F6N2+2 — CID 123299276
(1,1,1,5,5,5-hexafluoro-4-methylidyneazaniumylpent-2-en-2-yl)-methyl-methylideneazanium (PubChem CID 123299276) has the molecular formula C8H8F6N2+2 and a molecular weight of 246.15 g/mol. Its IUPAC name is (1,1,1,5,5,5-hexafluoro-4-methylidyneazaniumylpent-2-en-2-yl)-methyl-methylideneazanium.
| Compound Name | (1,1,1,5,5,5-hexafluoro-4-methylidyneazaniumylpent-2-en-2-yl)-methyl-methylideneazanium |
|---|---|
| PubChem CID | 123299276 |
| Molecular Formula | C8H8F6N2+2 |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (1,1,1,5,5,5-hexafluoro-4-methylidyneazaniumylpent-2-en-2-yl)-methyl-methylideneazanium |
| SMILES | C#[N+]C(C=C([N+](=C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F6N2/c1-15-5(7(9,10)11)4-6(16(2)3)8(12,13)14/h1,4-5H,2H2,3H3/q+2 |
| InChIKey | WCCYJADUNGHNNT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 7.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|