About ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid
ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid (PubChem CID 123300035) has the molecular formula C19H26FN3O3
and a molecular weight of 363.43 g/mol. Its IUPAC name is ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid.
Molecular Properties
| Compound Name | ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid |
| PubChem CID | 123300035 |
| Molecular Formula | C19H26FN3O3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid |
| SMILES | CCN(C(=O)O)[C@]1(C(=O)C2CCNCC2)CNC[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H26FN3O3/c1-2-23(18(25)26)19(17(24)14-7-9-21-10-8-14)12-22-11-16(19)13-3-5-15(20)6-4-13/h3-6,14,16,21-22H,2,7-12H2,1H3,(H,25,26)/t16-,19+/m0/s1 |
| InChIKey | JJHOPGOINFZIIV-QFBILLFUSA-N |
| XLogP | 1.82 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid?
The IUPAC name of ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid (CID 123300035) is ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid.
What is the SMILES notation for ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid?
The canonical SMILES for ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid is CCN(C(=O)O)[C@]1(C(=O)C2CCNCC2)CNC[C@H]1c1ccc(F)cc1.
What is the InChIKey of ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid?
The InChIKey is JJHOPGOINFZIIV-QFBILLFUSA-N. The full InChI is InChI=1S/C19H26FN3O3/c1-2-23(18(25)26)19(17(24)14-7-9-21-10-8-14)12-22-11-16(19)13-3-5-15(20)6-4-13/h3-6,14,16,21-22H,2,7-12H2,1H3,(H,25,26)/t16-,19+/m0/s1.
What are the key properties of ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid?
ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid has a molecular weight of 363.43 g/mol, XLogP of 1.82, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-[(3S,4R)-4-(4-fluorophenyl)-3-(piperidine-4-carbonyl)pyrrolidin-3-yl]carbamic acid is sourced from PubChem (CID 123300035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).