C16H18 — CID 123300058
3,10-dimethyl-3,4,9,10-tetrahydrophenanthrene (PubChem CID 123300058) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is 3,10-dimethyl-3,4,9,10-tetrahydrophenanthrene.
| Compound Name | 3,10-dimethyl-3,4,9,10-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 123300058 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3,10-dimethyl-3,4,9,10-tetrahydrophenanthrene |
| SMILES | CC1C=CC2=C(C1)c1ccccc1CC2C |
| InChI | InChI=1S/C16H18/c1-11-7-8-14-12(2)10-13-5-3-4-6-15(13)16(14)9-11/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | UHCRNWWCCGWAAU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |