C20H13Cl2F4NO2 — CID 123300171
3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-spiro[3H-2-benzofuran-1,3'-azetidine]-5-ylbut-2-en-1-one (PubChem CID 123300171) has the molecular formula C20H13Cl2F4NO2 and a molecular weight of 446.23 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-spiro[3H-2-benzofuran-1,3'-azetidine]-5-ylbut-2-en-1-one.
| Compound Name | 3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-spiro[3H-2-benzofuran-1,3'-azetidine]-5-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 123300171 |
| Molecular Formula | C20H13Cl2F4NO2 |
| Molecular Weight | 446.23 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-spiro[3H-2-benzofuran-1,3'-azetidine]-5-ylbut-2-en-1-one |
| SMILES | O=C(C=C(c1cc(Cl)c(F)c(Cl)c1)C(F)(F)F)c1ccc2c(c1)COC21CNC1 |
| InChI | InChI=1S/C20H13Cl2F4NO2/c21-15-4-11(5-16(22)18(15)23)14(20(24,25)26)6-17(28)10-1-2-13-12(3-10)7-29-19(13)8-27-9-19/h1-6,27H,7-9H2 |
| InChIKey | AUCPNDSUNNFYJC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.23 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|