C6H10N2 — CID 123300854
(Z)-N'-propan-2-ylideneprop-2-ene-1,3-diimine (PubChem CID 123300854) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is (Z)-N'-propan-2-ylideneprop-2-ene-1,3-diimine.
| Compound Name | (Z)-N'-propan-2-ylideneprop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 123300854 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | (Z)-N'-propan-2-ylideneprop-2-ene-1,3-diimine |
| SMILES | [H]/N=C/C=C\N=C(C)C |
| InChI | InChI=1S/C6H10N2/c1-6(2)8-5-3-4-7/h3-5,7H,1-2H3/b5-3-,7-4+ |
| InChIKey | LXOXRBONMIUCCQ-XKSOLRDRSA-N |
| XLogP | 1.63 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|