C12H18N2O3 — CID 123300863
methyl N-[1-(2-ethenylpyrrolidin-1-yl)-1-oxobut-3-en-2-yl]carbamate (PubChem CID 123300863) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is methyl N-[1-(2-ethenylpyrrolidin-1-yl)-1-oxobut-3-en-2-yl]carbamate.
| Compound Name | methyl N-[1-(2-ethenylpyrrolidin-1-yl)-1-oxobut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 123300863 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | methyl N-[1-(2-ethenylpyrrolidin-1-yl)-1-oxobut-3-en-2-yl]carbamate |
| SMILES | C=CC(NC(=O)OC)C(=O)N1CCCC1C=C |
| InChI | InChI=1S/C12H18N2O3/c1-4-9-7-6-8-14(9)11(15)10(5-2)13-12(16)17-3/h4-5,9-10H,1-2,6-8H2,3H3,(H,13,16) |
| InChIKey | GZPAKXFBUCDLHU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|