C22H17BrF3N5O — CID 123300877
N-(6-bromo-2-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 123300877) has the molecular formula C22H17BrF3N5O and a molecular weight of 504.31 g/mol. Its IUPAC name is N-(6-bromo-2-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-(6-bromo-2-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 123300877 |
| Molecular Formula | C22H17BrF3N5O |
| Molecular Weight | 504.31 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | N-(6-bromo-2-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cccc(Br)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CCC1C2 |
| InChI | InChI=1S/C22H17BrF3N5O/c23-18-5-2-6-19(28-18)29-21(32)31-15-9-10-30(12-15)17-8-7-16(27-20(17)31)13-3-1-4-14(11-13)22(24,25)26/h1-8,11,15H,9-10,12H2,(H,28,29,32) |
| InChIKey | GDMUYRNODCDCLM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.31 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|