C16H26F2S — CID 123300906
1-(difluoromethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene (PubChem CID 123300906) has the molecular formula C16H26F2S and a molecular weight of 288.45 g/mol. Its IUPAC name is 1-(difluoromethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene.
| Compound Name | 1-(difluoromethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 123300906 |
| Molecular Formula | C16H26F2S |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-(difluoromethylsulfanyl)-3,7,11-trimethyldodeca-2,6,10-triene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSC(F)F |
| InChI | InChI=1S/C16H26F2S/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-19-16(17)18/h7,9,11,16H,5-6,8,10,12H2,1-4H3 |
| InChIKey | FILMKWVLMFABEW-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|