About 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine
3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine (PubChem CID 123300960) has the molecular formula C11H19F6NO
and a molecular weight of 295.27 g/mol. Its IUPAC name is 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine.
Molecular Properties
| Compound Name | 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine |
| PubChem CID | 123300960 |
| Molecular Formula | C11H19F6NO |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine |
| SMILES | CCC(CC)CC(N)OCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H19F6NO/c1-3-7(4-2)5-9(18)19-6-8(10(12,13)14)11(15,16)17/h7-9H,3-6,18H2,1-2H3 |
| InChIKey | ZBIRAWZLFIBZSU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine?
The IUPAC name of 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine (CID 123300960) is 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine.
What is the SMILES notation for 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine?
The canonical SMILES for 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine is CCC(CC)CC(N)OCC(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine?
The InChIKey is ZBIRAWZLFIBZSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F6NO/c1-3-7(4-2)5-9(18)19-6-8(10(12,13)14)11(15,16)17/h7-9H,3-6,18H2,1-2H3.
What are the key properties of 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine?
3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine has a molecular weight of 295.27 g/mol, XLogP of 3.85, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine is sourced from PubChem (CID 123300960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).