C11H19F6NO — CID 123300960
3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine (PubChem CID 123300960) has the molecular formula C11H19F6NO and a molecular weight of 295.27 g/mol. Its IUPAC name is 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine.
| Compound Name | 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine |
|---|---|
| PubChem CID | 123300960 |
| Molecular Formula | C11H19F6NO |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-ethyl-1-[3,3,3-trifluoro-2-(trifluoromethyl)propoxy]pentan-1-amine |
| SMILES | CCC(CC)CC(N)OCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H19F6NO/c1-3-7(4-2)5-9(18)19-6-8(10(12,13)14)11(15,16)17/h7-9H,3-6,18H2,1-2H3 |
| InChIKey | ZBIRAWZLFIBZSU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|