C26H30N4O4 — CID 123301397
2-hydroxyethyl N-[4-[N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methylcarbamimidoyl]-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 123301397) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-hydroxyethyl N-[4-[N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methylcarbamimidoyl]-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | 2-hydroxyethyl N-[4-[N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methylcarbamimidoyl]-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 123301397 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-hydroxyethyl N-[4-[N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methylcarbamimidoyl]-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | C=C(N/C(=N\C)c1cccc2c1CCC2NC(=O)OCCO)c1ccc(OC(C)C)c(C#N)c1 |
| InChI | InChI=1S/C26H30N4O4/c1-16(2)34-24-11-8-18(14-19(24)15-27)17(3)29-25(28-4)22-7-5-6-21-20(22)9-10-23(21)30-26(32)33-13-12-31/h5-8,11,14,16,23,31H,3,9-10,12-13H2,1-2,4H3,(H,28,29)(H,30,32) |
| InChIKey | KBEBSBVTLMUQBQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|