C14H19NO2 — CID 123301575
1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrrole-2,5-dione (PubChem CID 123301575) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrrole-2,5-dione.
| Compound Name | 1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 123301575 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrrole-2,5-dione |
| SMILES | CC1(C)C2CCC1(C)C(N1C(=O)C=CC1=O)C2 |
| InChI | InChI=1S/C14H19NO2/c1-13(2)9-6-7-14(13,3)10(8-9)15-11(16)4-5-12(15)17/h4-5,9-10H,6-8H2,1-3H3 |
| InChIKey | SDVYLUNHHKJBGE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|