About N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine
N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine (PubChem CID 123301971) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine.
Molecular Properties
| Compound Name | N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine |
| PubChem CID | 123301971 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine |
| SMILES | C=CC(=CC)C(C=C)=CN=C |
| InChI | InChI=1S/C10H13N/c1-5-9(6-2)10(7-3)8-11-4/h5-8H,1,3-4H2,2H3 |
| InChIKey | UDGOXCKPEIIVGS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine?
The IUPAC name of N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine (CID 123301971) is N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine.
What is the SMILES notation for N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine?
The canonical SMILES for N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine is C=CC(=CC)C(C=C)=CN=C.
What is the InChIKey of N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine?
The InChIKey is UDGOXCKPEIIVGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-5-9(6-2)10(7-3)8-11-4/h5-8H,1,3-4H2,2H3.
What are the key properties of N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine?
N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine has a molecular weight of 147.22 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,3-bis(ethenyl)penta-1,3-dienyl]methanimine is sourced from PubChem (CID 123301971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).