C26H27FO3 — CID 123301994
(1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(4-fluorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123301994) has the molecular formula C26H27FO3 and a molecular weight of 406.50 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(4-fluorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(4-fluorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123301994 |
| Molecular Formula | C26H27FO3 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (1S,2R,6S,7R,8S)-4-(2,6-diethyl-4-methylphenyl)-8-(4-fluorophenyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)[C@@H]2[C@@H]3O[C@@H](C[C@H]3c3ccc(F)cc3)[C@@H]2C1=O |
| InChI | InChI=1S/C26H27FO3/c1-4-14-10-13(3)11-15(5-2)20(14)22-24(28)21-19-12-18(16-6-8-17(27)9-7-16)26(30-19)23(21)25(22)29/h6-11,18-19,21-23,26H,4-5,12H2,1-3H3/t18-,19-,21-,22?,23+,26+/m0/s1 |
| InChIKey | FOMLLZKLYWXXSY-JOOPMAATSA-N |
| XLogP | 4.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|