C32H51NO3 — CID 123302340
7-[4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]phenyl]-3,5,5,7-tetramethyloctan-4-one (PubChem CID 123302340) has the molecular formula C32H51NO3 and a molecular weight of 497.76 g/mol. Its IUPAC name is 7-[4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]phenyl]-3,5,5,7-tetramethyloctan-4-one.
| Compound Name | 7-[4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]phenyl]-3,5,5,7-tetramethyloctan-4-one |
|---|---|
| PubChem CID | 123302340 |
| Molecular Formula | C32H51NO3 |
| Molecular Weight | 497.76 g/mol |
| Exact Mass | 497.39 |
| IUPAC Name | 7-[4-[2,5-dihydroxy-3-(2-propylheptyl)pyrrol-1-yl]phenyl]-3,5,5,7-tetramethyloctan-4-one |
| SMILES | CCCCCC(CCC)Cc1cc(O)n(-c2ccc(C(C)(C)CC(C)(C)C(=O)C(C)CC)cc2)c1O |
| InChI | InChI=1S/C32H51NO3/c1-9-12-13-15-24(14-10-2)20-25-21-28(34)33(30(25)36)27-18-16-26(17-19-27)31(5,6)22-32(7,8)29(35)23(4)11-3/h16-19,21,23-24,34,36H,9-15,20,22H2,1-8H3 |
| InChIKey | OTQGLQKRJSABEU-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.76 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|