About 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide
3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide (PubChem CID 123302399) has the molecular formula C17H15Cl2F2NO3
and a molecular weight of 390.21 g/mol. Its IUPAC name is 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide |
| PubChem CID | 123302399 |
| Molecular Formula | C17H15Cl2F2NO3 |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide |
| SMILES | NC(=O)c1c(F)ccc(OCCCCOc2ccc(Cl)cc2Cl)c1F |
| InChI | InChI=1S/C17H15Cl2F2NO3/c18-10-3-5-13(11(19)9-10)24-7-1-2-8-25-14-6-4-12(20)15(16(14)21)17(22)23/h3-6,9H,1-2,7-8H2,(H2,22,23) |
| InChIKey | MDMPUORQZTZIOF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide?
The IUPAC name of 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide (CID 123302399) is 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide.
What is the SMILES notation for 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide?
The canonical SMILES for 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide is NC(=O)c1c(F)ccc(OCCCCOc2ccc(Cl)cc2Cl)c1F.
What is the InChIKey of 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide?
The InChIKey is MDMPUORQZTZIOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2F2NO3/c18-10-3-5-13(11(19)9-10)24-7-1-2-8-25-14-6-4-12(20)15(16(14)21)17(22)23/h3-6,9H,1-2,7-8H2,(H2,22,23).
What are the key properties of 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide?
3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide has a molecular weight of 390.21 g/mol, XLogP of 4.61, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,4-dichlorophenoxy)butoxy]-2,6-difluorobenzamide is sourced from PubChem (CID 123302399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).