C29H32N7O4+ — CID 123302406
2-[3-[4-[[6-[(4-hydroxycyclohexyl)amino]-7H-purin-9-ium-2-yl]amino]-3-methylphenoxy]propyl]isoindole-1,3-dione (PubChem CID 123302406) has the molecular formula C29H32N7O4+ and a molecular weight of 542.62 g/mol. Its IUPAC name is 2-[3-[4-[[6-[(4-hydroxycyclohexyl)amino]-7H-purin-9-ium-2-yl]amino]-3-methylphenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[[6-[(4-hydroxycyclohexyl)amino]-7H-purin-9-ium-2-yl]amino]-3-methylphenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 123302406 |
| Molecular Formula | C29H32N7O4+ |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 2-[3-[4-[[6-[(4-hydroxycyclohexyl)amino]-7H-purin-9-ium-2-yl]amino]-3-methylphenoxy]propyl]isoindole-1,3-dione |
| SMILES | Cc1cc(OCCCN2C(=O)c3ccccc3C2=O)ccc1Nc1nc(NC2CCC(O)CC2)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C29H31N7O4/c1-17-15-20(40-14-4-13-36-27(38)21-5-2-3-6-22(21)28(36)39)11-12-23(17)33-29-34-25-24(30-16-31-25)26(35-29)32-18-7-9-19(37)10-8-18/h2-3,5-6,11-12,15-16,18-19,37H,4,7-10,13-14H2,1H3,(H3,30,31,32,33,34,35)/p+1 |
| InChIKey | PMGQBSPBEWTYSG-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|