C19H40 — CID 123302800
4-ethyl-2,4,6-trimethyl-6-propylundecane (PubChem CID 123302800) has the molecular formula C19H40 and a molecular weight of 268.53 g/mol. Its IUPAC name is 4-ethyl-2,4,6-trimethyl-6-propylundecane.
| Compound Name | 4-ethyl-2,4,6-trimethyl-6-propylundecane |
|---|---|
| PubChem CID | 123302800 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | 4-ethyl-2,4,6-trimethyl-6-propylundecane |
| SMILES | CCCCCC(C)(CCC)CC(C)(CC)CC(C)C |
| InChI | InChI=1S/C19H40/c1-8-11-12-14-19(7,13-9-2)16-18(6,10-3)15-17(4)5/h17H,8-16H2,1-7H3 |
| InChIKey | YTLJADDXTWDOJN-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|