2-methylbut-2-enimidoyl chloride

C5H8ClN — CID 123302884

IUPAC2-methylbut-2-enimidoyl chloride
SMILES[H]/N=C(\Cl)C(C)=CC
InChIInChI=1S/C5H8ClN/c1-3-4(2)5(6)7/h3,7H,1-2H3/b4-3?,7-5-
InChIKeyUUUBOFNYSINRIF-YFPBZNGSSA-N
MW117.58 g/mol
LogP2.17
Rot. Bonds1

About 2-methylbut-2-enimidoyl chloride

2-methylbut-2-enimidoyl chloride (PubChem CID 123302884) has the molecular formula C5H8ClN and a molecular weight of 117.58 g/mol. Its IUPAC name is 2-methylbut-2-enimidoyl chloride.

Molecular Properties

Compound Name2-methylbut-2-enimidoyl chloride
PubChem CID123302884
Molecular FormulaC5H8ClN
Molecular Weight117.58 g/mol
Exact Mass117.03
IUPAC Name2-methylbut-2-enimidoyl chloride
SMILES[H]/N=C(\Cl)C(C)=CC
InChIInChI=1S/C5H8ClN/c1-3-4(2)5(6)7/h3,7H,1-2H3/b4-3?,7-5-
InChIKeyUUUBOFNYSINRIF-YFPBZNGSSA-N
XLogP2.17
TPSA23.85 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500117.58
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 2-methylbut-2-enimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylbut-2-enimidoyl chloride?
The IUPAC name of 2-methylbut-2-enimidoyl chloride (CID 123302884) is 2-methylbut-2-enimidoyl chloride.
What is the SMILES notation for 2-methylbut-2-enimidoyl chloride?
The canonical SMILES for 2-methylbut-2-enimidoyl chloride is [H]/N=C(\Cl)C(C)=CC.
What is the InChIKey of 2-methylbut-2-enimidoyl chloride?
The InChIKey is UUUBOFNYSINRIF-YFPBZNGSSA-N. The full InChI is InChI=1S/C5H8ClN/c1-3-4(2)5(6)7/h3,7H,1-2H3/b4-3?,7-5-.
What are the key properties of 2-methylbut-2-enimidoyl chloride?
2-methylbut-2-enimidoyl chloride has a molecular weight of 117.58 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-2-enimidoyl chloride is sourced from PubChem (CID 123302884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).