C23H27ClN10 — CID 123303944
4-chloro-3-[[4-(ethylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[3-(4-methylpiperazin-1-yl)propyl]benzonitrile (PubChem CID 123303944) has the molecular formula C23H27ClN10 and a molecular weight of 478.99 g/mol. Its IUPAC name is 4-chloro-3-[[4-(ethylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[3-(4-methylpiperazin-1-yl)propyl]benzonitrile.
| Compound Name | 4-chloro-3-[[4-(ethylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[3-(4-methylpiperazin-1-yl)propyl]benzonitrile |
|---|---|
| PubChem CID | 123303944 |
| Molecular Formula | C23H27ClN10 |
| Molecular Weight | 478.99 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 4-chloro-3-[[4-(ethylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-5-[3-(4-methylpiperazin-1-yl)propyl]benzonitrile |
| SMILES | [C-]#[N+]c1cnc2c(NCC)nc(Nc3cc(C#N)cc(CCCN4CCN(C)CC4)c3Cl)nn12 |
| InChI | InChI=1S/C23H27ClN10/c1-4-27-21-22-28-15-19(26-2)34(22)31-23(30-21)29-18-13-16(14-25)12-17(20(18)24)6-5-7-33-10-8-32(3)9-11-33/h12-13,15H,4-11H2,1,3H3,(H2,27,29,30,31) |
| InChIKey | PHRMVEWKHHPZQJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.99 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|