About 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine
2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine (PubChem CID 123304406) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine.
Molecular Properties
| Compound Name | 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine |
| PubChem CID | 123304406 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine |
| SMILES | [C-]#[N+]C(=CN(C)C)c1[nH]ncc1C |
| InChI | InChI=1S/C9H12N4/c1-7-5-11-12-9(7)8(10-2)6-13(3)4/h5-6H,1,3-4H3,(H,11,12) |
| InChIKey | WUXYBONIUVBWKH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 36.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine?
The IUPAC name of 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine (CID 123304406) is 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine.
What is the SMILES notation for 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine?
The canonical SMILES for 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine is [C-]#[N+]C(=CN(C)C)c1[nH]ncc1C.
What is the InChIKey of 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine?
The InChIKey is WUXYBONIUVBWKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-7-5-11-12-9(7)8(10-2)6-13(3)4/h5-6H,1,3-4H3,(H,11,12).
What are the key properties of 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine?
2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine has a molecular weight of 176.22 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyano-N,N-dimethyl-2-(4-methyl-1H-pyrazol-5-yl)ethenamine is sourced from PubChem (CID 123304406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).