About 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene
7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene (PubChem CID 123304898) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene |
| PubChem CID | 123304898 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene |
| SMILES | COC1=CC2OCC(SC)C=C2C=C1 |
| InChI | InChI=1S/C11H14O2S/c1-12-9-4-3-8-5-10(14-2)7-13-11(8)6-9/h3-6,10-11H,7H2,1-2H3 |
| InChIKey | GQLCVJLCCUWDAD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene?
The IUPAC name of 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene (CID 123304898) is 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene.
What is the SMILES notation for 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene?
The canonical SMILES for 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene is COC1=CC2OCC(SC)C=C2C=C1.
What is the InChIKey of 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene?
The InChIKey is GQLCVJLCCUWDAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S/c1-12-9-4-3-8-5-10(14-2)7-13-11(8)6-9/h3-6,10-11H,7H2,1-2H3.
What are the key properties of 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene?
7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene has a molecular weight of 210.30 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3-methylsulfanyl-3,8a-dihydro-2H-chromene is sourced from PubChem (CID 123304898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).