C47H38BN3O2 — CID 123305055
5,11-diphenyl-2-(4-pyridin-4-ylphenyl)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indolo[3,2-b]carbazole (PubChem CID 123305055) has the molecular formula C47H38BN3O2 and a molecular weight of 687.65 g/mol. Its IUPAC name is 5,11-diphenyl-2-(4-pyridin-4-ylphenyl)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indolo[3,2-b]carbazole.
| Compound Name | 5,11-diphenyl-2-(4-pyridin-4-ylphenyl)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 123305055 |
| Molecular Formula | C47H38BN3O2 |
| Molecular Weight | 687.65 g/mol |
| Exact Mass | 687.31 |
| IUPAC Name | 5,11-diphenyl-2-(4-pyridin-4-ylphenyl)-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indolo[3,2-b]carbazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)c2cc4c(cc2n3-c2ccccc2)c2cc(-c3ccc(-c5ccncc5)cc3)ccc2n4-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C47H38BN3O2/c1-46(2)47(3,4)53-48(52-46)35-20-22-43-39(28-35)41-30-44-40(29-45(41)51(43)37-13-9-6-10-14-37)38-27-34(19-21-42(38)50(44)36-11-7-5-8-12-36)32-17-15-31(16-18-32)33-23-25-49-26-24-33/h5-30H,1-4H3 |
| InChIKey | ZWMMQNWTDVSJCW-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 41.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.65 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|