C22H22N2O3 — CID 123305156
1-ethyl-4,5-dioxo-N-[(1R)-6-phenyl-2,3-dihydro-1H-inden-1-yl]pyrrolidine-3-carboxamide (PubChem CID 123305156) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-ethyl-4,5-dioxo-N-[(1R)-6-phenyl-2,3-dihydro-1H-inden-1-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-ethyl-4,5-dioxo-N-[(1R)-6-phenyl-2,3-dihydro-1H-inden-1-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123305156 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-ethyl-4,5-dioxo-N-[(1R)-6-phenyl-2,3-dihydro-1H-inden-1-yl]pyrrolidine-3-carboxamide |
| SMILES | CCN1CC(C(=O)N[C@@H]2CCc3ccc(-c4ccccc4)cc32)C(=O)C1=O |
| InChI | InChI=1S/C22H22N2O3/c1-2-24-13-18(20(25)22(24)27)21(26)23-19-11-10-15-8-9-16(12-17(15)19)14-6-4-3-5-7-14/h3-9,12,18-19H,2,10-11,13H2,1H3,(H,23,26)/t18?,19-/m1/s1 |
| InChIKey | DLGVOIBKFTTWMG-MUMRKEEXSA-N |
| XLogP | 2.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|