C25H23ClN5O4+ — CID 123305401
3-(3-chloro-4-isocyanophenyl)-1-[3-[[5-(1-hydroxypyridin-1-ium-4-yl)-2-pyridinyl]oxy]propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 123305401) has the molecular formula C25H23ClN5O4+ and a molecular weight of 492.94 g/mol. Its IUPAC name is 3-(3-chloro-4-isocyanophenyl)-1-[3-[[5-(1-hydroxypyridin-1-ium-4-yl)-2-pyridinyl]oxy]propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-(3-chloro-4-isocyanophenyl)-1-[3-[[5-(1-hydroxypyridin-1-ium-4-yl)-2-pyridinyl]oxy]propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 123305401 |
| Molecular Formula | C25H23ClN5O4+ |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 3-(3-chloro-4-isocyanophenyl)-1-[3-[[5-(1-hydroxypyridin-1-ium-4-yl)-2-pyridinyl]oxy]propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)N(CCCOc3ccc(-c4cc[n+](O)cc4)cn3)C(C)(C)C2=O)cc1Cl |
| InChI | InChI=1S/C25H23ClN5O4/c1-25(2)23(32)31(19-6-7-21(27-3)20(26)15-19)24(33)30(25)11-4-14-35-22-8-5-18(16-28-22)17-9-12-29(34)13-10-17/h5-10,12-13,15-16,34H,4,11,14H2,1-2H3/q+1 |
| InChIKey | OJTIDFCOHCDEPX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|