About (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine
(7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine (PubChem CID 123305691) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine.
Molecular Properties
| Compound Name | (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine |
| PubChem CID | 123305691 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine |
| SMILES | [H]/N=C/C1=NCCC2=CC=C(C)C21C |
| InChI | InChI=1S/C11H14N2/c1-8-3-4-9-5-6-13-10(7-12)11(8,9)2/h3-4,7,12H,5-6H2,1-2H3/b12-7+ |
| InChIKey | XDBWJRKUBVZCLR-KPKJPENVSA-N |
| XLogP | 2.37 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine?
The IUPAC name of (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine (CID 123305691) is (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine.
What is the SMILES notation for (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine?
The canonical SMILES for (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine is [H]/N=C/C1=NCCC2=CC=C(C)C21C.
What is the InChIKey of (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine?
The InChIKey is XDBWJRKUBVZCLR-KPKJPENVSA-N. The full InChI is InChI=1S/C11H14N2/c1-8-3-4-9-5-6-13-10(7-12)11(8,9)2/h3-4,7,12H,5-6H2,1-2H3/b12-7+.
What are the key properties of (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine?
(7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine has a molecular weight of 174.25 g/mol, XLogP of 2.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7,7a-dimethyl-3,4-dihydrocyclopenta[c]pyridin-1-yl)methanimine is sourced from PubChem (CID 123305691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).