C16H26O — CID 123305978
(1S,2R,5R,7R,9S,12S)-1,2,5,10,12-pentamethyl-8-oxatricyclo[7.2.1.02,7]dodec-10-ene (PubChem CID 123305978) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (1S,2R,5R,7R,9S,12S)-1,2,5,10,12-pentamethyl-8-oxatricyclo[7.2.1.02,7]dodec-10-ene.
| Compound Name | (1S,2R,5R,7R,9S,12S)-1,2,5,10,12-pentamethyl-8-oxatricyclo[7.2.1.02,7]dodec-10-ene |
|---|---|
| PubChem CID | 123305978 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (1S,2R,5R,7R,9S,12S)-1,2,5,10,12-pentamethyl-8-oxatricyclo[7.2.1.02,7]dodec-10-ene |
| SMILES | CC1=C[C@@]2(C)[C@H](C)[C@@H]1O[C@@H]1C[C@H](C)CC[C@@]12C |
| InChI | InChI=1S/C16H26O/c1-10-6-7-15(4)13(8-10)17-14-11(2)9-16(15,5)12(14)3/h9-10,12-14H,6-8H2,1-5H3/t10-,12-,13-,14-,15+,16+/m1/s1 |
| InChIKey | HAYOMNLINCGDCC-VVUSHAQISA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|