C16H21NO — CID 123306173
(4E,7Z,9Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenedodeca-4,7,9,11-tetraen-2-one (PubChem CID 123306173) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (4E,7Z,9Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenedodeca-4,7,9,11-tetraen-2-one.
| Compound Name | (4E,7Z,9Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenedodeca-4,7,9,11-tetraen-2-one |
|---|---|
| PubChem CID | 123306173 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (4E,7Z,9Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenedodeca-4,7,9,11-tetraen-2-one |
| SMILES | [H]/N=C/C(/C=C(\C)C(=C)/C=C(C)\C=C/C=C)C(C)=O |
| InChI | InChI=1S/C16H21NO/c1-6-7-8-12(2)9-13(3)14(4)10-16(11-17)15(5)18/h6-11,16-17H,1,3H2,2,4-5H3/b8-7-,12-9-,14-10+,17-11+ |
| InChIKey | NHSUUGPSUHHOFL-FGQIHMAQSA-N |
| XLogP | 4.03 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|