About [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid
[2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid (PubChem CID 123306684) has the molecular formula C14H19BO5
and a molecular weight of 278.11 g/mol. Its IUPAC name is [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid.
Molecular Properties
| Compound Name | [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid |
| PubChem CID | 123306684 |
| Molecular Formula | C14H19BO5 |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid |
| SMILES | COC(=O)[C@@H]1CC[C@@H](c2ccc(OC)c(B(O)O)c2)C1 |
| InChI | InChI=1S/C14H19BO5/c1-19-13-6-5-10(8-12(13)15(17)18)9-3-4-11(7-9)14(16)20-2/h5-6,8-9,11,17-18H,3-4,7H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | OICPGWYOMWYDEO-MWLCHTKSSA-N |
| XLogP | 0.43 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid?
The IUPAC name of [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid (CID 123306684) is [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid.
What is the SMILES notation for [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid?
The canonical SMILES for [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid is COC(=O)[C@@H]1CC[C@@H](c2ccc(OC)c(B(O)O)c2)C1.
What is the InChIKey of [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid?
The InChIKey is OICPGWYOMWYDEO-MWLCHTKSSA-N. The full InChI is InChI=1S/C14H19BO5/c1-19-13-6-5-10(8-12(13)15(17)18)9-3-4-11(7-9)14(16)20-2/h5-6,8-9,11,17-18H,3-4,7H2,1-2H3/t9-,11-/m1/s1.
What are the key properties of [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid?
[2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid has a molecular weight of 278.11 g/mol, XLogP of 0.43, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-5-[(1R,3R)-3-methoxycarbonylcyclopentyl]phenyl]boronic acid is sourced from PubChem (CID 123306684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).