C24H27ClFN9 — CID 123306974
1-N-[1-[[2-(3-aminoazetidin-1-yl)-9-(3-fluorophenyl)purin-6-yl]amino]butan-2-yl]-4-chlorobenzene-1,2-diamine (PubChem CID 123306974) has the molecular formula C24H27ClFN9 and a molecular weight of 495.99 g/mol. Its IUPAC name is 1-N-[1-[[2-(3-aminoazetidin-1-yl)-9-(3-fluorophenyl)purin-6-yl]amino]butan-2-yl]-4-chlorobenzene-1,2-diamine.
| Compound Name | 1-N-[1-[[2-(3-aminoazetidin-1-yl)-9-(3-fluorophenyl)purin-6-yl]amino]butan-2-yl]-4-chlorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 123306974 |
| Molecular Formula | C24H27ClFN9 |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 1-N-[1-[[2-(3-aminoazetidin-1-yl)-9-(3-fluorophenyl)purin-6-yl]amino]butan-2-yl]-4-chlorobenzene-1,2-diamine |
| SMILES | CCC(CNc1nc(N2CC(N)C2)nc2c1ncn2-c1cccc(F)c1)Nc1ccc(Cl)cc1N |
| InChI | InChI=1S/C24H27ClFN9/c1-2-17(31-20-7-6-14(25)8-19(20)28)10-29-22-21-23(33-24(32-22)34-11-16(27)12-34)35(13-30-21)18-5-3-4-15(26)9-18/h3-9,13,16-17,31H,2,10-12,27-28H2,1H3,(H,29,32,33) |
| InChIKey | UDHDYMIANSLJTK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|