C23H28F3N3O4 — CID 123307151
7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(4,4,4-trifluorobutyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione (PubChem CID 123307151) has the molecular formula C23H28F3N3O4 and a molecular weight of 467.49 g/mol. Its IUPAC name is 7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(4,4,4-trifluorobutyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | 7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(4,4,4-trifluorobutyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 123307151 |
| Molecular Formula | C23H28F3N3O4 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 7a-hydroxy-3a-(5-hydroxy-2-methylphenyl)-1-(4,4,4-trifluorobutyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccc(O)cc1C12CC3CN(CCCC(F)(F)F)C3C1(O)CCC1(C2)NC(=O)NC1=O |
| InChI | InChI=1S/C23H28F3N3O4/c1-13-3-4-15(30)9-16(13)20-10-14-11-29(8-2-5-23(24,25)26)17(14)22(20,33)7-6-21(12-20)18(31)27-19(32)28-21/h3-4,9,14,17,30,33H,2,5-8,10-12H2,1H3,(H2,27,28,31,32) |
| InChIKey | VIHOGKLMBHHWRM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|