C28H29NO3 — CID 123307266
(1S,5R)-3-(2-ethyl-5-quinolin-2-yloxyphenyl)-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione (PubChem CID 123307266) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is (1S,5R)-3-(2-ethyl-5-quinolin-2-yloxyphenyl)-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1S,5R)-3-(2-ethyl-5-quinolin-2-yloxyphenyl)-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 123307266 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | (1S,5R)-3-(2-ethyl-5-quinolin-2-yloxyphenyl)-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(Oc2ccc3ccccc3n2)cc1C1C(=O)[C@@H]2CC[C@](C)(C1=O)C2(C)C |
| InChI | InChI=1S/C28H29NO3/c1-5-17-10-12-19(32-23-13-11-18-8-6-7-9-22(18)29-23)16-20(17)24-25(30)21-14-15-28(4,26(24)31)27(21,2)3/h6-13,16,21,24H,5,14-15H2,1-4H3/t21-,24?,28+/m0/s1 |
| InChIKey | UAVLNVSINUTMDZ-QDGAEUMWSA-N |
| XLogP | 6.27 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|