About 3-ethyl-5,6-difluoro-2H-indazole
3-ethyl-5,6-difluoro-2H-indazole (PubChem CID 123307421) has the molecular formula C9H8F2N2
and a molecular weight of 182.17 g/mol. Its IUPAC name is 3-ethyl-5,6-difluoro-2H-indazole.
Molecular Properties
| Compound Name | 3-ethyl-5,6-difluoro-2H-indazole |
| PubChem CID | 123307421 |
| Molecular Formula | C9H8F2N2 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 3-ethyl-5,6-difluoro-2H-indazole |
| SMILES | CCc1[nH]nc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C9H8F2N2/c1-2-8-5-3-6(10)7(11)4-9(5)13-12-8/h3-4H,2H2,1H3,(H,12,13) |
| InChIKey | VLHAGNVYWHVJGP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-5,6-difluoro-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5,6-difluoro-2H-indazole?
The IUPAC name of 3-ethyl-5,6-difluoro-2H-indazole (CID 123307421) is 3-ethyl-5,6-difluoro-2H-indazole.
What is the SMILES notation for 3-ethyl-5,6-difluoro-2H-indazole?
The canonical SMILES for 3-ethyl-5,6-difluoro-2H-indazole is CCc1[nH]nc2cc(F)c(F)cc12.
What is the InChIKey of 3-ethyl-5,6-difluoro-2H-indazole?
The InChIKey is VLHAGNVYWHVJGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2N2/c1-2-8-5-3-6(10)7(11)4-9(5)13-12-8/h3-4H,2H2,1H3,(H,12,13).
What are the key properties of 3-ethyl-5,6-difluoro-2H-indazole?
3-ethyl-5,6-difluoro-2H-indazole has a molecular weight of 182.17 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5,6-difluoro-2H-indazole is sourced from PubChem (CID 123307421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).