C21H20Cl3F3N3+ — CID 123307520
aminomethylidene-propyl-[[4-[4,4,4-trifluoro-3-(2,3,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]azanium (PubChem CID 123307520) has the molecular formula C21H20Cl3F3N3+ and a molecular weight of 477.77 g/mol. Its IUPAC name is aminomethylidene-propyl-[[4-[4,4,4-trifluoro-3-(2,3,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]azanium.
| Compound Name | aminomethylidene-propyl-[[4-[4,4,4-trifluoro-3-(2,3,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]azanium |
|---|---|
| PubChem CID | 123307520 |
| Molecular Formula | C21H20Cl3F3N3+ |
| Molecular Weight | 477.77 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | aminomethylidene-propyl-[[4-[4,4,4-trifluoro-3-(2,3,5-trichlorophenyl)but-1-enyl]phenyl]iminomethyl]azanium |
| SMILES | CCC[N+](/C=N/c1ccc(C=CC(c2cc(Cl)cc(Cl)c2Cl)C(F)(F)F)cc1)=C\N |
| InChI | InChI=1S/C21H19Cl3F3N3/c1-2-9-30(12-28)13-29-16-6-3-14(4-7-16)5-8-18(21(25,26)27)17-10-15(22)11-19(23)20(17)24/h3-8,10-13,18,28H,2,9H2,1H3/p+1/b8-5?,29-13+ |
| InChIKey | SKFIFBMKEZJGLZ-ISPGIIFESA-O |
| XLogP | 7.08 |
| TPSA | 41.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.77 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|