C28H36N6O2 — CID 123307583
8-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)-3-[4-(2-hydroxyethyl)-3-methylpiperazin-1-yl]-1,9-dimethyl-9,10-dihydropyrido[1,2-a]azocin-6-one (PubChem CID 123307583) has the molecular formula C28H36N6O2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 8-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)-3-[4-(2-hydroxyethyl)-3-methylpiperazin-1-yl]-1,9-dimethyl-9,10-dihydropyrido[1,2-a]azocin-6-one.
| Compound Name | 8-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)-3-[4-(2-hydroxyethyl)-3-methylpiperazin-1-yl]-1,9-dimethyl-9,10-dihydropyrido[1,2-a]azocin-6-one |
|---|---|
| PubChem CID | 123307583 |
| Molecular Formula | C28H36N6O2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 8-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)-3-[4-(2-hydroxyethyl)-3-methylpiperazin-1-yl]-1,9-dimethyl-9,10-dihydropyrido[1,2-a]azocin-6-one |
| SMILES | CC1=CC(N2CCN(CCO)C(C)C2)=CN2C(=O)C=C(c3cc4c(C)nc(C)cn4n3)C(C)CC=C12 |
| InChI | InChI=1S/C28H36N6O2/c1-18-6-7-26-19(2)12-23(32-9-8-31(10-11-35)21(4)16-32)17-33(26)28(36)13-24(18)25-14-27-22(5)29-20(3)15-34(27)30-25/h7,12-15,17-18,21,35H,6,8-11,16H2,1-5H3 |
| InChIKey | LDUSELASROAFOU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |